| Melting point |
5.0-6.5°C |
| Boiling point |
118 °C / 2mmHg |
| Density |
1.192-1.204 |
| refractive index |
1.5020-1.5060 |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
-1.54±0.70(Predicted) |
| form |
Liquid |
| color |
Colorless to Red to Green |
| Water Solubility |
5g/L(20 ºC) |
| Merck |
3049 |
| Henry's Law Constant |
3.1×101 mol/(m3Pa) at 25℃, Hilal et al. (2008) |
| Major Application |
agriculture environmental |
| InChI |
InChI=1S/C8H11Cl2NO/c1-3-5-11(6-4-2)8(12)7(9)10/h3-4,7H,1-2,5-6H2 |
| InChIKey |
YRMLFORXOOIJDR-UHFFFAOYSA-N |
| SMILES |
C(N(CC=C)CC=C)(=O)C(Cl)Cl |
| CAS DataBase Reference |
37764-25-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Dichlormid (37764-25-3) |