Dichlormid
- Product NameDichlormid
- CAS37764-25-3
- MFC8H11Cl2NO
- MW208.09
- EINECS253-658-8
- MOL File37764-25-3.mol
Chemical Properties
| Melting point | 5.0-6.5°C |
| Boiling point | 118 °C / 2mmHg |
| Density | 1.192-1.204 |
| refractive index | 1.5020-1.5060 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -1.54±0.70(Predicted) |
| form | Liquid |
| color | Colorless to Red to Green |
| Water Solubility | 5g/L(20 ºC) |
| Merck | 3049 |
| Henry's Law Constant | 3.1×101 mol/(m3Pa) at 25℃, Hilal et al. (2008) |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C8H11Cl2NO/c1-3-5-11(6-4-2)8(12)7(9)10/h3-4,7H,1-2,5-6H2 |
| InChIKey | YRMLFORXOOIJDR-UHFFFAOYSA-N |
| SMILES | C(N(CC=C)CC=C)(=O)C(Cl)Cl |
| CAS DataBase Reference | 37764-25-3(CAS DataBase Reference) |
| EPA Substance Registry System | Dichlormid (37764-25-3) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 22-23 |
| Safety Statements | 45 |
| WGK Germany | 3 |
| RTECS | AB6080000 |
| TSCA | TSCA listed |
| HS Code | 2924.19.1150 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| Hazardous Substances Data | 37764-25-3(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 2146 mg/kg (Fed. Regist.) |
