| Melting point |
196-202 °C |
| Boiling point |
388.65°C (rough estimate) |
| alpha |
-61.5 º (c=5, water) |
| Density |
1.4340 |
| refractive index |
-62 ° (C=3, H2O) |
| storage temp. |
2-8°C |
| solubility |
36g/l |
| form |
Fine Crystalline Powder |
| pka |
12.80±0.70(Predicted) |
| color |
White |
| Water Solubility |
36 g/L (15 ºC), 250 g/L (60 ºC) |
| Merck |
14,8324 |
| BRN |
89593 |
| Stability |
Stable, but light sensitive. Incompatible with strong oxidizing agents. |
| Major Application |
cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING |
| InChI |
1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey |
NGFMICBWJRZIBI-MICYEWLZSA-N |
| SMILES |
OC[C@H]1O[C@@H](Oc2ccccc2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP |
-1.232 (est) |
| CAS DataBase Reference |
138-52-3(CAS DataBase Reference) |
| NIST Chemistry Reference |
Salicin(138-52-3) |
| EPA Substance Registry System |
.beta.-D-Glucopyranoside, 2-(hydroxymethyl)phenyl (138-52-3) |