| Melting point |
153-155 °C(lit.) |
| Boiling point |
368.97°C (rough estimate) |
| Density |
1.13 |
| vapor density |
7.9 (vs air) |
| refractive index |
1.5780 (estimate) |
| storage temp. |
Store below +30°C. |
| solubility |
ethanol: 0.1 g/mL, clear |
| pka |
10.92±0.40(Predicted) |
| form |
Crystalline Powder |
| color |
White to almost white |
| Odor |
Odorless |
| optical activity |
0.2°(C=0.01g/mI, CHCL3, 20°C, 589nm) |
| Water Solubility |
Slightly soluble in water |
| Sensitive |
Light Sensitive |
| Merck |
14,1094 |
| BRN |
2051941 |
| Stability |
Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| InChI |
1S/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13+ |
| InChIKey |
WAKHLWOJMHVUJC-FYWRMAATSA-N |
| SMILES |
O\N=C(\C(O)c1ccccc1)c2ccccc2 |
| CAS DataBase Reference |
441-38-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Ethanone, 2-hydroxy-1,2-diphenyl-, oxime (441-38-3) |
