| Melting point |
0.05°C |
| Boiling point |
586.77°C (rough estimate) |
| Density |
1.06 g/mL at 20 °C |
| vapor pressure |
<0.01 hPa (20 °C) |
| refractive index |
n20/D 1.492 |
| Flash point |
>230 °F |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form |
Liquid |
| color |
Yellow |
| PH |
5.0-8.0 (10g/l, H2O, 20℃) |
| biological source |
synthetic (organic) |
| Water Solubility |
Miscible with water. |
| Merck |
13,6793 |
| BRN |
2315025 |
| Hydrophilic-Lipophilic Balance (HLB) |
12.4 |
| Dielectric constant |
9.8(29.0℃) |
| InChI |
1S/C28H50O8/c1-27(2,3)24-28(4,5)25-6-8-26(9-7-25)36-23-22-35-21-20-34-19-18-33-17-16-32-15-14-31-13-12-30-11-10-29/h6-9,29H,10-24H2,1-5H3 |
| InChIKey |
HNLXNOZHXNSSPN-UHFFFAOYSA-N |
| SMILES |
CC(C)(C)CC(C)(C)c1ccc(OCCOCCOCCOCCOCCOCCOCCO)cc1 |
| CAS DataBase Reference |
9036-19-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Polyethylene glycol mono(1,1,3,3-tetramethylbutyl)phenyl ether (9036-19-5) |
| Absorption |
cut-off at 310nm |