| Melting point |
219-220 °C (lit.) |
| Boiling point |
517.84°C (rough estimate) |
| Density |
1.56 |
| bulk density |
580kg/m3 |
| refractive index |
1.5700 (estimate) |
| Flash point |
200 °C |
| storage temp. |
room temp |
| solubility |
0.1 M NaOH: 0.1 M at 20 °C, clear, colorless |
| pka |
pK1:;pK2:2.55(+1);pK3:4.33(+2);pK4:8.60(-3);pK5,10.58 (25°C) |
| form |
Crystalline Powder |
| color |
White to almost white |
| PH |
2-3 (H2O, 20℃)(saturated solution) |
| biological source |
synthetic (organic) |
| Water Solubility |
5 g/L (20 ºC) |
| Merck |
14,7125 |
| BRN |
1810219 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
CHELATING |
| InChI |
1S/C14H23N3O10/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey |
QPCDCPDFJACHGM-UHFFFAOYSA-N |
| SMILES |
OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CCN(CC(O)=O)CC(O)=O |
| LogP |
-1.361 (est) |
| CAS DataBase Reference |
67-43-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
N,N-Bis(2-(bis-(carboxymethyl)amino)ethyl)-glycine(67-43-6) |
| EPA Substance Registry System |
Pentetic acid (67-43-6) |
