| Melting point |
199°C(lit.) |
| Density |
1.55±0.1 g/cm3(Predicted) |
| storage temp. |
-20°C |
| solubility |
Soluble in DMSO (up to 10 mg/ml). |
| pka |
8.29±0.10(Predicted) |
| form |
powder |
| color |
White or off-white |
| Appearance |
light beige to light brown solid |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 2 months. |
| InChI |
InChI=1S/C11H12N2O5/c1-2-6-4-13(11(17)12-10(6)16)9-3-7(15)8(5-14)18-9/h1,4,7-9,14-15H,3,5H2,(H,12,16,17)/t7-,8+,9+/m0/s1 |
| InChIKey |
CDEURGJCGCHYFH-DJLDLDEBSA-N |
| SMILES |
OC[C@H]1O[C@@H](N2C=C(C#C)C(=O)NC2=O)C[C@@H]1O |
| CAS DataBase Reference |
61135-33-9 |
