| Boiling point |
250 °C |
| Density |
1.08 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.49 |
| Flash point |
91°C |
| storage temp. |
2-8°C, stored under nitrogen |
| form |
Liquid |
| Specific Gravity |
1.095 |
| Appearance |
Colorless to light yellow Liquid |
| Water Solubility |
Miscible with toluene, primary alcohols, ketones, benzene, chlorinated hydrocarbons, acetonitrile, dimethylformaminde and dimethysulfoxide. Immiscible with water. |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| BRN |
2062235 |
| InChI |
InChI=1S/C18H42O6S4Si2/c1-7-19-29(20-8-2,21-9-3)17-13-15-25-27-28-26-16-14-18-30(22-10-4,23-11-5)24-12-6/h7-18H2,1-6H3 |
| InChIKey |
VTHOKNTVYKTUPI-UHFFFAOYSA-N |
| SMILES |
CCO[Si](OCC)(OCC)CCCSSSSCCC[Si](OCC)(OCC)OCC |
| CAS DataBase Reference |
40372-72-3(CAS DataBase Reference) |
| EPA Substance Registry System |
3,16-Dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy- (40372-72-3) |