| Melting point |
<0°C |
| Boiling point |
123-125°C |
| Density |
1.03 g/mL at 20 °C (lit.) |
| vapor pressure |
0.035Pa at 25℃ |
| refractive index |
1.569~1.571 |
| Flash point |
137 °C |
| storage temp. |
2-8°C |
| solubility |
ethanol: 50 mL/L, clear, brown |
| pka |
5.02±0.70(Predicted) |
| form |
Liquid |
| color |
Yellow to Very Dark Brown |
| Water Solubility |
<0.1 g/100 mL at 20 ºC |
| Merck |
14,3753 |
| BRN |
158223 |
| Stability |
Stable. Combustible. Incompatible with oxidizing agents, strong acids. Polymerizes if heated. May polymerize upon exposure to light and air. |
| Major Application |
cleaning products
cosmetics
food and beverages
personal care |
| InChI |
1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3 |
| InChIKey |
DECIPOUIJURFOJ-UHFFFAOYSA-N |
| SMILES |
CCOc1ccc2NC(C)(C)C=C(C)c2c1 |
| LogP |
3.39 |
| CAS DataBase Reference |
91-53-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl-(91-53-2) |
| EPA Substance Registry System |
Ethoxyquin (91-53-2) |
