| Melting point |
< −120 °C (−184 °F; 153 K) |
| Boiling point |
65 to 66 °C (149 to 151 °F; 338 to 339 K) |
| Density |
1.682 g/mL |
| vapor pressure |
16.665kPa at 20℃ |
| refractive index |
n 20/D 1.3 (lit.) |
| Flash point |
Not applicable |
| storage temp. |
Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility |
Chloroform (Sparingly), Methanol (Sparingly) |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Specific Gravity |
1.682 |
| Water Solubility |
Hydrolyses in water. |
| Sensitive |
Moisture Sensitive |
| BRN |
1813589 |
| Stability |
Hygroscopic |
| InChI |
1S/C4F10O2S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16 |
| InChIKey |
LUYQYZLEHLTPBH-UHFFFAOYSA-N |
| SMILES |
FC(F)(F)C(F)(F)C(F)(F)C(F)(F)S(F)(=O)=O |
| CAS DataBase Reference |
375-72-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Nonafluorobutanesulfonyl fluoride(375-72-4) |
| EPA Substance Registry System |
1-Butanesulfonyl fluoride, 1,1,2,2,3,3,4,4,4-nonafluoro- (375-72-4) |
