| Melting point |
-88 °C |
| Boiling point |
67 °C |
| Density |
2.06 |
| refractive index |
1.33 |
| Flash point |
None |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| form |
clear liquid |
| Specific Gravity |
2.010 |
| color |
Colorless to Light yellow to Red |
| Water Solubility |
immiscible |
| Sensitive |
Light Sensitive |
| BRN |
1777546 |
| Stability |
Stable. Incompatible with bases. |
| InChI |
1S/C4F9I/c5-1(6,3(9,10)11)2(7,8)4(12,13)14 |
| InChIKey |
PGRFXXCKHGIFSV-UHFFFAOYSA-N |
| SMILES |
FC(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| CAS DataBase Reference |
423-39-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
1-Iodononafluorobutane(423-39-2) |
| EPA Substance Registry System |
Butane, 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodo- (423-39-2) |
