| Melting point |
>360 °C(lit.) |
| Boiling point |
708.6±60.0 °C(Predicted) |
| Density |
1.3423 (rough estimate) |
| refractive index |
1.5060 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Slightly soluble in DMSO, ethanol, methanol DMF and acetone |
| form |
powder |
| pka |
2.2, 4.4, 6.7(at 25℃) |
| color |
White |
| PH Range |
Weak green uorescence (6.0) to strong green uorescence (7.2) |
| Appearance |
Yellow solid |
| Water Solubility |
practically insoluble |
| Sensitive |
Moisture Sensitive |
| λmax |
490nm |
| ex/em |
492/520 nm (PBS buffer) |
| ε(extinction coefficient) |
74,000 L⋅mol−1⋅cm−1 |
| Φ(quantum yield) |
0.92 |
| BRN |
1407295 |
| Stability |
Stability Stable, but moisture-sensitive. Incompatible with strong oxidizing agents, strong bases, amines, acids. |
| Major Application |
Magnetic nanowires, immunoassays, analyzing proteins, identifying chromosomes, Salmonella mosomes, diagnosis of cancer, kidney diseases, detecting pathogens, genes, Salmonella cells, toxoplasmosis, enzyme-mediated nucleic acid cleavage, surface molecules on colorectal cancers, treating cancer, chronic lymphocytic leukemia |
| Biological Applications |
Analyzing sugar
chain; detecting iodide/iodate or total iodine;
detecting/imaging thiols; detecting/quantifying biotin
derivatives;16 diagnosing classical Hodgkin lymphoma
(CHL) in lymph nodes; cellulose nanocrystals for
bioimaging applications; treating neuroinflammation;
treating/diagnosing cancer; PEO-PCL-PEO triblock
copolymers for topical delivery; polymersomes in
biomedical or cosmetic applications;apoptosis assay;
as a substrate for measuring heparanase activity, human
immunodeficiency virus (HIV-1) proteinase activity,
kinase activity, phosphatase activity, β-lactamase
activity, transglutaminase (TG2) activity; implantable
drug-delivery devicess |
| InChI |
1S/C21H11NO5S/c23-12-2-5-16-18(8-12)26-19-9-13(24)3-6-17(19)21(16)15-4-1-11(22-10-28)7-14(15)20(25)27-21/h1-9,23-24H |
| InChIKey |
MHMNJMPURVTYEJ-UHFFFAOYSA-N |
| SMILES |
Oc1ccc2c(Oc3cc(O)ccc3C24OC(=O)c5cc(ccc45)N=C=S)c1 |
| CAS DataBase Reference |
3326-32-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-5-isothiocyanato- (3326-32-7) |