| Melting point |
170-173 °C (lit.) |
| Boiling point |
236-238 °C/10 mmHg (lit.) |
| Density |
1.1404 (rough estimate) |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.6600 (estimate) |
| Flash point |
209 °C |
| storage temp. |
2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| color |
Light orange to Yellow to Green |
| Water Solubility |
Soluble in water 1.234 mg/L @ 25°C. |
| Merck |
14,6021 |
| BRN |
2050523 |
| InChI |
1S/C15H10O2/c1-9-6-7-12-13(8-9)15(17)11-5-3-2-4-10(11)14(12)16/h2-8H,1H3 |
| InChIKey |
NJWGQARXZDRHCD-UHFFFAOYSA-N |
| SMILES |
Cc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| LogP |
3.4 at 25℃ |
| CAS DataBase Reference |
84-54-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
9,10-Anthracenedione, 2-methyl-(84-54-8) |
| EPA Substance Registry System |
2-Methylanthraquinone (84-54-8) |
