| Melting point |
~185 °C (dec.) |
| Boiling point |
511.79°C (rough estimate) |
| Density |
1.4951 (rough estimate) |
| refractive index |
1.5000 (estimate) |
| storage temp. |
2-8°C |
| solubility |
DMF: 10 mg/ml; DMSO: 10 mg/ml; DMSO:PBS (pH 7.2) (1:7): 0.125 mg/ml |
| form |
Fine Powder |
| pka |
1.71±0.10(Predicted) |
| color |
Brown |
| Water Solubility |
Slightly soluble (0.2 g/L) |
| BRN |
2190028 |
| Stability |
Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C19H15NO8/c21-13(22)7-20(8-14(23)24)6-9-5-12-15(19(28)16(9)25)18(27)11-4-2-1-3-10(11)17(12)26/h1-5,25,28H,6-8H2,(H,21,22)(H,23,24) |
| InChIKey |
PWIGYBONXWGOQE-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)CN(CC(O)=O)CC1=C(O)C(O)=C2C(=C1)C(=O)C1=C(C=CC=C1)C2=O |
| CAS DataBase Reference |
3952-78-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Glycine, N-(carboxymethyl)-N-[(9,10-dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenyl)methyl]- (3952-78-1) |