| Melting point |
211-215 °C |
| Density |
1.0387 (rough estimate) |
| refractive index |
1.6800 (estimate) |
| storage temp. |
2-8°C, sealed storage, away from moisture |
| solubility |
acetonitrile: 0.1 g/mL, clear, colorless |
| form |
Crystalline Powder |
| color |
White |
| Water Solubility |
Soluble in acetonitrile and ethanol. Very slightly soluble in water. |
| Sensitive |
Hygroscopic |
| BRN |
3579274 |
| Stability |
Stable. Strong oxidizer - contact with combustible material may cause fire. Incompatible with strong reducing agents, combustible materials. Do not heat. |
| InChI |
InChI=1S/C16H36N.ClHO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5/h5-16H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey |
KBLZDCFTQSIIOH-UHFFFAOYSA-M |
| SMILES |
[N+](CCCC)(CCCC)(CCCC)CCCC.Cl([O-])(=O)(=O)=O |
| CAS DataBase Reference |
1923-70-2(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Butanaminium, N,N,N-tributyl-, perchlorate (1923-70-2) |