1923-70-2
| Name | Tetrabutylammonium perchlorate |
| CAS | 1923-70-2 |
| EINECS(EC#) | 217-655-5 |
| Molecular Formula | C16H36ClNO4 |
| MDL Number | MFCD00038722 |
| Molecular Weight | 341.91 |
| MOL File | 1923-70-2.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 211-215 °C |
| density | 1.0387 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder |
| color | White |
| Stability: | Stable. Strong oxidizer-contact with combustible material may cause fire. Incompatible with strong reducing agents, combustible materials. Do not heat. |
| Water Solubility | Soluble in acetonitrile and ethanol. Very slightly soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3579274 |
| InChI | InChI=1S/C16H36N.ClHO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5/h5-16H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KBLZDCFTQSIIOH-UHFFFAOYSA-M |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.Cl([O-])(=O)(=O)=O |
| CAS DataBase Reference | 1923-70-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1923-70-2(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS03,GHS07 |
| Signal word | Danger |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | O,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 5.1 |
| PackingGroup | II |
| HS Code | 28299000 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |
