
429-41-4
| Name | Tetrabutylammonium fluoride |
| CAS | 429-41-4 |
| EINECS(EC#) | 207-057-2 |
| Molecular Formula | C16H36FN |
| MDL Number | MFCD00149980 |
| Molecular Weight | 261.46 |
| MOL File | 429-41-4.mol |
Chemical Properties
| Appearance | Clear light greenish to amber or brown solution |
| Melting point | 62-63 °C(lit.) |
| density | 0.953 g/mL at 25 °C |
| refractive index | n |
| Fp | 1 °F |
| storage temp. | 2-8°C |
| solubility | Miscible with terahydrofuran, acetonitrile, dimethyl sulfoxide and organic solvents. |
| form | Solution |
| color | Clear light greenish to brown |
| Water Solubility | Insoluble in water. |
| Sensitive | Hygroscopic |
| Merck | 9187 |
| BRN | 3570522 |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| InChI | 1S/C16H36N.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| SMILES | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 429-41-4(CAS DataBase Reference) |
| Storage Precautions | Heat sensitive |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H411 |
| Precautionary statements | P264-P270-P273-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | C,F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 3 |
| Hazard Note | Flammable/Irritant |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29239000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 |

