Fmoc-OSu
- Product NameFmoc-OSu
- CAS82911-69-1
- CBNumberCB9428667
- MFC19H15NO5
- MW337.33
- EINECS433-520-5
- MDL NumberMFCD00010733
- MOL File82911-69-1.mol
Chemical Properties
| Melting point: | 150-153 °C(lit.) |
| Boiling point: | 150-153°C |
| Density | 1.3460 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in dimethyl sulfoxide and dimethyl formamide. |
| form | Microfine Powder |
| color | White or almost white |
| Sensitive | Moisture Sensitive |
| BRN | 3569540 |
| Stability: | Moisture Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C19H15NO5/c21-17-9-10-18(22)20(17)25-19(23)24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2 |
| InChIKey | WMSUFWLPZLCIHP-UHFFFAOYSA-N |
| SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)ON1C(=O)CCC1=O |
| CAS DataBase Reference | 82911-69-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS07,GHS09 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H317-H411 | |||||||||
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi,N,Xn | |||||||||
| Risk Statements | 36/37/38-51/53-43-22 | |||||||||
| Safety Statements | 22-24/25-26/37/39-26-61-37-24 | |||||||||
| RIDADR | UN 3077 9 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| Hazard Note | Moisture Sensitive | |||||||||
| HazardClass | 9 | |||||||||
| HS Code | 29251995 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Aquatic Chronic 2 Skin Sens. 1 |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
