Tris(trimethylsilyl)phosphate
- Product NameTris(trimethylsilyl)phosphate
- CAS10497-05-9
- CBNumberCB3713871
- MFC9H27O4PSi3
- MW314.54
- EINECS234-028-1
- MDL NumberMFCD00008267
- MOL File10497-05-9.mol
Chemical Properties
| Melting point: | 3-4 °C (lit.) |
| Boiling point: | 228-229 °C/720 mmHg (lit.) |
| Density | 0.945 g/mL at 25 °C (lit.) |
| vapor pressure | 23.3hPa at 20℃ |
| refractive index | n |
| Flash point: | 76 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 23-25(at 25℃) |
| form | liquid |
| Specific Gravity | 0.959 |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 935.5μg/L at 20℃ |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1794624 |
| InChI | 1S/C9H27O4PSi3/c1-15(2,3)11-14(10,12-16(4,5)6)13-17(7,8)9/h1-9H3 |
| InChIKey | QJMMCGKXBZVAEI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| LogP | 4.72 at 20℃ |
| CAS DataBase Reference | 10497-05-9(CAS DataBase Reference) |
| EPA Substance Registry System | Silanol, trimethyl-, phosphate (3:1) (10497-05-9) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 11-36/37/38 | |||||||||
| Safety Statements | 16-26-36 | |||||||||
| RIDADR | UN 1993 3/PG 2 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | TC9700000 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2931.90.9010 | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|
