Diminazene aceturate
- Product NameDiminazene aceturate
- CAS908-54-3
- CBNumberCB9161027
- MFC22H29N9O6
- MW515.52
- EINECS212-999-2
- MDL NumberMFCD00058386
- MOL File908-54-3.mol
Chemical Properties
| Melting point: | 202 °C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder |
| color | Orange to Dark Orange |
| Water Solubility | Soluble to 100 mM in water |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C14H15N7.2C4H7NO3/c15-13(16)9-1-5-11(6-2-9)19-21-20-12-7-3-10(4-8-12)14(17)18;2*1-3(6)5-2-4(7)8/h1-8H,(H3,15,16)(H3,17,18)(H,19,20);2*2H2,1H3,(H,5,6)(H,7,8) |
| InChIKey | OKQSSSVVBOUMNZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC(O)=O.CC(=O)NCC(O)=O.NC(=N)c1ccc(N\N=N\c2ccc(cc2)C(N)=N)cc1 |
| CAS DataBase Reference | 908-54-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | MB7605000 |
| Storage Class | 11 - Combustible Solids |