Bis(triphenylphosphine)nickel(II)chloride
- Product NameBis(triphenylphosphine)nickel(II)chloride
- CAS14264-16-5
- CBNumberCB8433158
- MFC36H30Cl2NiP2
- MW654.17
- EINECS238-154-8
- MDL NumberMFCD00009592
- MOL File14264-16-5.mol
Chemical Properties
| Melting point: | 250 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystals or Powder |
| color | Dark green to dark gray |
| Water Solubility | insoluble |
| Sensitive | Hygroscopic |
| Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 |
| InChI | InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2 |
| InChIKey | ZBRJXVVKPBZPAN-UHFFFAOYSA-L |
| SMILES | P(C1C=CC=CC=1)(C1=CC=CC=C1)C1C=CC=CC=1.P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.[Ni](Cl)Cl |
| CAS DataBase Reference | 14264-16-5(CAS DataBase Reference) |
| NIST Chemistry Reference | dichlorobis(triphenylphosphine)nickel(14264-16-5) |
| EPA Substance Registry System | Nickel, dichlorobis(triphenylphosphine)- (14264-16-5) |
Safety
| Symbol(GHS) |
  GHS07,GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H317-H350-H412 | |||||||||
| Precautionary statements | P201-P273-P280-P302+P352-P308+P313 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 45-43-52/53-34-20/21/22 | |||||||||
| Safety Statements | 53-36/37-45-60-36/37/39-26 | |||||||||
| RIDADR | 3260 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | QR6170000 | |||||||||
| F | 21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29310095 | |||||||||
| Storage Class |
6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
|||||||||
| Hazard Classifications |
Aquatic Chronic 3 Carc. 1B Skin Sens. 1 |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
