5-Chloro-2-nitropyridine
- Product Name5-Chloro-2-nitropyridine
- CAS52092-47-4
- CBNumberCB8115018
- MFC5H3ClN2O2
- MW158.54
- EINECS639-354-1
- MDL NumberMFCD03092916
- MOL File52092-47-4.mol
Chemical Properties
| Melting point: | 119-123℃ |
| Boiling point: | 275.3±20.0 °C(Predicted) |
| Density | 1.489±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -4.87±0.22(Predicted) |
| form | crystalline powder |
| color | White to very faint yellow |
| InChI | InChI=1S/C5H3ClN2O2/c6-4-1-2-5(7-3-4)8(9)10/h1-3H |
| InChIKey | YUBHMOQVHOODEI-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=C(Cl)C=C1 |
| CAS DataBase Reference | 52092-47-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
   GHS05,GHS07,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335-H400 | |||||||||
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xi,N,Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38-50-41-22 | |||||||||
| Safety Statements | 26-36/37/39-36-61-37/39 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 2933399090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
