2-Chloro-3-methyl-5-nitropyridine
- Product Name2-Chloro-3-methyl-5-nitropyridine
- CAS22280-56-4
- CBNumberCB7319385
- MFC6H5ClN2O2
- MW172.57
- EINECS244-889-5
- MDL NumberMFCD00173686
- MOL File22280-56-4.mol
Chemical Properties
| Melting point: | 45-50 °C |
| Boiling point: | 145 °C / 18mmHg |
| Density | 1.5610 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | >110°C |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| pka | -3.61±0.10(Predicted) |
| form | Crystalline Powder |
| color | Light beige to cream |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C6H5ClN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| InChIKey | OSIOIGXJUZTWRI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1C |
| CAS DataBase Reference | 22280-56-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 36/37/38-20/21/22-41-37/38-22 | |||||||||
| Safety Statements | 37/39-26-39 | |||||||||
| RIDADR | UN 2811 6.1 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2933399090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
