4-Morpholinopiperidine
- Product Name4-Morpholinopiperidine
- CAS53617-35-9
- CBNumberCB7423547
- MFC9H18N2O
- MW170.25
- EINECS627-580-3
- MDL NumberMFCD03274733
- MOL File53617-35-9.mol
Chemical Properties
| Melting point: | 40-43 °C(lit.) |
| Boiling point: | 100-115 °C0.15-0.20 mm Hg(lit.) |
| Density | 1.033±0.06 g/cm3(Predicted) |
| vapor pressure | 0.63-4.58Pa at 25-45℃ |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 10.21±0.10(Predicted) |
| form | Solid |
| Appearance | Colorless to off-white Solid |
| InChI | InChI=1S/C9H18N2O/c1-3-10-4-2-9(1)11-5-7-12-8-6-11/h9-10H,1-8H2 |
| InChIKey | YYBXNWIRMJXEQJ-UHFFFAOYSA-N |
| SMILES | N1(C2CCNCC2)CCOCC1 |
| LogP | 0.3 at 25℃ and pH11 |
| Dissociation constant | 5.44-10.1 at 20℃ |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |
