4,5-Dichloro-1,2-benzenediamine
- Product Name4,5-Dichloro-1,2-benzenediamine
- CAS5348-42-5
- CBNumberCB7189469
- MFC6H6Cl2N2
- MW177.03
- EINECS226-305-0
- MDL NumberMFCD00007723
- MOL File5348-42-5.mol
Chemical Properties
| Melting point: | 158-164 °C(lit.) |
| Boiling point: | 291.88°C (rough estimate) |
| Density | 1.4668 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Crystalline Powder |
| pka | 2.77±0.10(Predicted) |
| color | Red-brown to brown |
| Water Solubility | Soluble in methanol and Dimethyl sulfoxide. Insoluble in water. |
| BRN | 1072811 |
| InChI | InChI=1S/C6H6Cl2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,9-10H2 |
| InChIKey | IWFHBRFJOHTIPU-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=C(Cl)C=C1N |
| CAS DataBase Reference | 5348-42-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,5-Dichloro-ortho-phenylenediamine(5348-42-5) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38-40 | |||||||||
| Safety Statements | 26-36-45-36/37 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 29215900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|