Trifluoroacetic anhydride
- Product NameTrifluoroacetic anhydride
- CAS407-25-0
- CBNumberCB6853606
- MFC4F6O3
- MW210.03
- EINECS206-982-9
- MDL NumberMFCD00000416
- MOL File407-25-0.mol
Chemical Properties
| Melting point: | −65 °C (−85 °F; 208 K) |
| Boiling point: | 40 °C (104 °F; 313 K) |
| Density | 1.511 g/mL (20°C) |
| vapor pressure | 6.28 psi ( 20 °C) |
| refractive index | n 20/D 1.3 (lit.) |
| Flash point: | -26 °C |
| storage temp. | 2-8°C |
| solubility | Miscible with benzene, dichloromethane, diethyl ether, dimethylformamide, terahydrofuran and acetonitrile. |
| form | liquid |
| pka | 0.43[at 20 ℃] |
| color | colorless |
| Specific Gravity | 1.487 |
| Water Solubility | Hydrolysis |
| Sensitive | Moisture Sensitive |
| BRN | 746197 |
| Stability: | Stable, but moisture sensitive. Reacts with water to liberate hydrogen (flammable!). Incompatible with water, strong oxidizing agents. |
| InChI | 1S/C4F6O3/c5-3(6,7)1(11)13-2(12)4(8,9)10 |
| InChIKey | QAEDZJGFFMLHHQ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=O)OC(=O)C(F)(F)F |
| LogP | 0.79 at 25℃ |
| CAS DataBase Reference | 407-25-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, trifluoro-, anhydride(407-25-0) |
| EPA Substance Registry System | Acetic acid, trifluoro-, anhydride (407-25-0) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H312+H332-H314-H412-H290 | |||||||||
| Precautionary statements | P501-P261-P273-P270-P234-P271-P264-P280-P390-P362+P364-P303+P361+P353-P301+P330+P331-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P406-P405 | |||||||||
| PPE | Faceshields, Gloves, Goggles | |||||||||
| Hazard Codes | C,T | |||||||||
| Risk Statements | 14-20-35-52/53-34-23/24/25 | |||||||||
| Safety Statements | 26-36/37/39-43-45-61-9-8-28A-27 | |||||||||
| RIDADR | UN 3265 8/PG 1 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | AJ9800000 | |||||||||
| F | 3-10 | |||||||||
| Hazard Note | Corrosive/Moisture Sensitive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | I | |||||||||
| HS Code | 2915900090 | |||||||||
| Storage Class | 8B - Non-combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Acute Tox. 4 Inhalation Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1A |
|||||||||
| Toxicity | skn-rbt 500 mg/24H SEV 28ZPAK -,91,72 | |||||||||
| REACH Registrations | Active | |||||||||
| Excepted Quantities | Not Permitted as Excepted Quantity | |||||||||
| NFPA 704: |
|