(-)-3,4-Dihydroxynorephedrine
- Product Name(-)-3,4-Dihydroxynorephedrine
- CAS829-74-3
- CBNumberCB6344074
- MFC9H13NO3
- MW183.2
- MDL NumberMFCD00134415
- MOL File829-74-3.mol
Chemical Properties
| Melting point: | 212-215°C dec. |
| alpha | D25 -31.0° (c = 0.5 in 0.01N HCl) |
| Boiling point: | 431.6±40.0 °C(Predicted) |
| Density | 1.328±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMSO: soluble5mg/mL, clear (warmed) |
| pka | 9.59±0.10(Predicted) |
| form | powder |
| color | white to light brown |
| Merck | 13,6725 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3/t5-,9-/m0/s1 |
| InChIKey | GEFQWZLICWMTKF-CDUCUWFYSA-N |
| SMILES | C[C@H](N)[C@H](O)c1ccc(O)c(O)c1 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312+P330-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 2811 6.1 / PGII | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2922504500 | |||||||||
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
|||||||||
| Hazard Classifications |
Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Toxicity | LD50 in mice (mg/kg): 12.6 i.v. (Luduena) | |||||||||
| NFPA 704: |
|