829-74-3
| Name | (-)-3,4-Dihydroxynorephedrine |
| CAS | 829-74-3 |
| Molecular Formula | C9H13NO3 |
| MDL Number | MFCD00134415 |
| Molecular Weight | 183.2 |
| MOL File | 829-74-3.mol |
Chemical Properties
| Appearance | White Powder |
| Melting point | 212-215°C dec. |
| alpha | D25 -31.0° (c = 0.5 in 0.01N HCl) |
| Boiling point | 431.6±40.0 °C(Predicted) |
| density | 1.328±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMSO: soluble5mg/mL, clear (warmed) |
| form | powder |
| pka | 9.59±0.10(Predicted) |
| color | white to light brown |
| Merck | 13,6725 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3/t5-,9-/m0/s1 |
| InChIKey | GEFQWZLICWMTKF-CDUCUWFYSA-N |
| SMILES | C[C@H](N)[C@H](O)c1ccc(O)c(O)c1 |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | 3 |
| HS Code | 2922504500 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |