Dichlorotriphenylphosphorane
- Product NameDichlorotriphenylphosphorane
- CAS2526-64-9
- CBNumberCB5136171
- MFC18H15Cl2P
- MW333.19
- EINECS607-677-7
- MDL NumberMFCD00010359
- MOL File2526-64-9.mol
Chemical Properties
| Melting point: | 85 °C (dec.) (lit.) |
| Flash point: | 68 °F |
| storage temp. | Storage temp. 2-8°C |
| solubility | Chloroform (Soluble), Dichloromethane (Slightly) |
| form | Solid |
| color | White to Light Yellow |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| Stability: | Extremely Moisture Sensitive, Hygroscopic |
| InChI | InChI=1S/C18H15Cl2P/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | ASWXNYNXAOQCCD-UHFFFAOYSA-N |
| SMILES | P(Cl)(Cl)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Safety
| Symbol(GHS) |
   GHS02,GHS05,GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H314-H350 | |||||||||
| Precautionary statements | P210-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | F,T | |||||||||
| Risk Statements | 45-11-34 | |||||||||
| Safety Statements | 53-26-36/37/39-45-16 | |||||||||
| RIDADR | UN 2925 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 4.1B - Flammable solid hazardous materials | |||||||||
| Hazard Classifications |
Carc. 1B Eye Dam. 1 Flam. Sol. 2 Skin Corr. 1B |
|||||||||
| NFPA 704: |
|