Tacalcitol
- Product NameTacalcitol
- CAS57333-96-7
- CBNumberCB4875440
- MFC27H44O3
- MW416.64
- MOL File57333-96-7.mol
Chemical Properties
| Boiling point: | 565.0±50.0 °C(Predicted) |
| Density | 1.06 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | 20mg/mL in DMSO, 20mg/mL in DMF, 20mg/mL in Ethanol |
| pka | 14.43±0.40(Predicted) |
| form | Powder |
| color | White to off-white |
| biological source | synthetic (organic) |
| InChIKey | BJYLYJCXYAMOFT-RSFVBTMBSA-N |
| SMILES | [C@@H]1(O)C/C(=C/C=C2\CCC[C@@]3(C)[C@@]\2([H])CC[C@@H]3[C@H](C)CC[C@@H](O)C(C)C)/C(=C)[C@@H](O)C1 |
| CAS DataBase Reference | 57333-96-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Oral |