3-Methyl-1-octylimidazolium chloride
- Product Name3-Methyl-1-octylimidazolium chloride
- CAS64697-40-1
- CBNumberCB3731499
- MFC12H23ClN2
- MW230.78
- EINECS629-150-0
- MDL NumberMFCD03095432
- MOL File64697-40-1.mol
Chemical Properties
| Melting point: | 12 °C |
| Density | 1.01 g/mL at 20 °C (lit.) |
| refractive index | 1.51 |
| Flash point: | Not applicable |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C12H23N2.ClH/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;/h10-12H,3-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OXFBEEDAZHXDHB-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCCCCCC[n+]1ccn(C)c1 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HS Code | 2933290090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 |
|||||||||
| NFPA 704: |
|