3-Methyl-1-octylimidazolium hexafluorophosphate
- Product Name3-Methyl-1-octylimidazolium hexafluorophosphate
- CAS304680-36-2
- CBNumberCB5286519
- MFC12H23F6N2P
- MW340.29
- EINECS200-145-6
- MDL NumberMFCD03427617
- MOL File304680-36-2.mol
Chemical Properties
| Melting point: | -70 °C |
| Density | 1.24 |
| refractive index | 1.42 |
| Flash point: | Not applicable |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C12H23N2.F6P/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-7(2,3,4,5)6/h10-12H,3-9H2,1-2H3;/q+1;-1 |
| InChIKey | GRCIJNHHTXBJAK-UHFFFAOYSA-N |
| SMILES | F[P-](F)(F)(F)(F)F.CCCCCCCC[n+]1ccn(C)c1 |
| EPA Substance Registry System | 1-Methyl-3-octylimidazolium hexafluorophosphate (304680-36-2) |
| ECW | 4.5 V |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HS Code | 2933290090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|