5-Aminofluorescein
- Product Name5-Aminofluorescein
- CAS3326-34-9
- CBNumberCB3254491
- MFC20H13NO5
- MW347.32
- EINECS222-043-6
- MDL NumberMFCD00005052
- MOL File3326-34-9.mol
Chemical Properties
| Melting point: | 223 °C (dec.)(lit.) |
| Boiling point: | 481.89°C (rough estimate) |
| Density | 1.3724 (rough estimate) |
| refractive index | 1.5180 (estimate) |
| storage temp. | room temp |
| solubility | DMF: 5 mg/ml; DMSO: 5 mg/ml |
| pka | 9.34±0.20(Predicted) |
| form | powder |
| color | red-brown |
| Appearance | Solid Powder |
| Water Solubility | Soluble in water (partly), methanol (10 mg/ml), and acetone. |
| λmax | 496 nm |
| BRN | 48395 |
| Stability: | Light and Moisture Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C20H13NO5/c21-10-1-4-14-13(7-10)19(24)26-20(14)15-5-2-11(22)8-17(15)25-18-9-12(23)3-6-16(18)20/h1-9,22-23H,21H2 |
| InChIKey | GZAJOEGTZDUSKS-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)OC23c4ccc(O)cc4Oc5cc(O)ccc35 |
| CAS DataBase Reference | 3326-34-9(CAS DataBase Reference) |
| EPA Substance Registry System | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 5-amino-3',6'-dihydroxy- (3326-34-9) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 32049090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|