3326-34-9
| Name | 5-Aminofluorescein |
| CAS | 3326-34-9 |
| EINECS(EC#) | 222-043-6 |
| Molecular Formula | C20H13NO5 |
| MDL Number | MFCD00005052 |
| Molecular Weight | 347.32 |
| MOL File | 3326-34-9.mol |
Chemical Properties
| Appearance | Dark Red Solid |
| Melting point | 223 °C (dec.)(lit.) |
| Boiling point | 481.89°C (rough estimate) |
| density | 1.3724 (rough estimate) |
| refractive index | 1.5180 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF: 5 mg/ml; DMSO: 5 mg/ml |
| form | powder |
| pka | 9.34±0.20(Predicted) |
| color | red-brown |
| Water Solubility | Soluble in water (partly), methanol (10 mg/ml), and acetone. |
| Usage | Fluorescent labeling reagent for proteins. Used in the fluorescent antibody technique for rapid identification of pathogens |
| λmax | 496 nm |
| BRN | 48395 |
| Stability: | Light and Moisture Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C20H13NO5/c21-10-1-4-14-13(7-10)19(24)26-20(14)15-5-2-11(22)8-17(15)25-18-9-12(23)3-6-16(18)20/h1-9,22-23H,21H2 |
| InChIKey | GZAJOEGTZDUSKS-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)OC23c4ccc(O)cc4Oc5cc(O)ccc35 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| TSCA | Yes |
| HS Code | 32049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |