N,N,N',N'-Tetramethyl-1,4-butanediamine
- Product NameN,N,N',N'-Tetramethyl-1,4-butanediamine
- CAS111-51-3
- CBNumberCB1282467
- MFC8H20N2
- MW144.26
- EINECS203-878-5
- MDL NumberMFCD00008338
- MOL File111-51-3.mol
Chemical Properties
| Melting point: | -100 °C |
| Boiling point: | 100 °C/97.5 mmHg |
| Density | 0.79 |
| refractive index | 1.43 |
| Flash point: | 46 °C |
| storage temp. | Store below +30°C. |
| pka | 10.00±0.28(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Merck | 14,9226 |
| BRN | 1735538 |
| InChI | InChI=1S/C8H20N2/c1-9(2)7-5-6-8-10(3)4/h5-8H2,1-4H3 |
| InChIKey | VEAZEPMQWHPHAG-UHFFFAOYSA-N |
| SMILES | C(N(C)C)CCCN(C)C |
| CAS DataBase Reference | 111-51-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Butanediamine, N,N,N',N'-tetramethyl- (111-51-3) |
Safety
| Symbol(GHS) |
  GHS02,GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H314 | |||||||||
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 10-34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2734 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | EJ7530000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2921290090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Flam. Liq. 3 Skin Corr. 1B |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|