Kaempferol-7-O-glucoside
- Product NameKaempferol-7-O-glucoside
- CAS16290-07-6
- CBNumberCB0259026
- MFC21H20O11
- MW448.38
- EINECS300-006-1
- MDL NumberMFCD08459623
- MOL File16290-07-6.mol
Chemical Properties
| Melting point: | 269-271℃ |
| Boiling point: | 810.2±65.0 °C(Predicted) |
| Density | 1.736 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO: soluble |
| form | A solid |
| pka | 5.94±0.40(Predicted) |
| color | Light yellow to yellow |
| BRN | 68205 |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | YPWHZCPMOQGCDQ-FJOWETSVNA-N |
| SMILES | C1(O)=C(C2=CC=C(C=C2)O)OC2C=C(C=C(O)C=2C1=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |&1:21,23,26,28,30,r| |
| LogP | -0.190 (est) |
Safety
| Symbol(GHS) |
 GHS08 |
| Signal word | Danger |
| Hazard statements | H304 |
| Precautionary statements | P501-P331-P301+P310-P405 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2938909090 |
| Storage Class | 11 - Combustible Solids |