1-Bromo-2,4,5-trifluorobenzene
- Product Name1-Bromo-2,4,5-trifluorobenzene
- CAS327-52-6
- CBNumberCB9696743
- MFC6H2BrF3
- MW210.98
- EINECS206-318-8
- MDL NumberMFCD00000306
- MOL File327-52-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | −19 °C(lit.) |
| Boiling point | 144 °C(lit.) |
| Density | 1.802 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 132 °F |
| storage temp. | 2-8°C |
| solubility | water: insoluble |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.81 |
| Water Solubility | insoluble |
| BRN | 1636588 |
| InChI | InChI=1S/C6H2BrF3/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| InChIKey | DVTULTINXNWGJY-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=C(F)C=C1F |
| CAS DataBase Reference | 327-52-6(CAS DataBase Reference) |
| FDA UNII | 5848WZ4MBL |
| NIST Chemistry Reference | Benzene, 1-bromo-2,4,5-trifluoro-(327-52-6) |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,F | |||||||||
| Risk Statements | 36/37/38-10 | |||||||||
| Safety Statements | 26-36/37/39-37/39-16 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Flammable | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29039990 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
