
327-52-6
| Name | 1-Bromo-2,4,5-trifluorobenzene |
| CAS | 327-52-6 |
| EINECS(EC#) | 206-318-8 |
| Molecular Formula | C6H2BrF3 |
| MDL Number | MFCD00000306 |
| Molecular Weight | 210.98 |
| MOL File | 327-52-6.mol |
Chemical Properties
| Appearance | clear slightly yellow liquid |
| Melting point | −19 °C(lit.) |
| Boiling point | 144 °C(lit.) |
| density | 1.802 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 132 °F |
| storage temp. | Sealed in dry,2-8°C |
| solubility | water: insoluble |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.81 |
| Water Solubility | insoluble |
| Usage | Intermediates of Liquid Crystals |
| BRN | 1636588 |
| InChI | InChI=1S/C6H2BrF3/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| InChIKey | DVTULTINXNWGJY-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=C(F)C=C1F |
| CAS DataBase Reference | 327-52-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2,4,5-trifluoro-(327-52-6) |
Safety Data
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |