25-HYDROXYVITAMIN D2
- Product Name25-HYDROXYVITAMIN D2
- CAS21343-40-8
- CBNumberCB9502507
- MFC28H44O2
- MW412.65
- EINECS606-742-7
- MDL NumberMFCD02683431
- MOL File21343-40-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 45-51°C |
| Boiling point | 542.3±38.0 °C(Predicted) |
| Density | 1.02±0.1 g/cm3(Predicted) |
| Flash point | 14℃ |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | Limited solubility, soluble in DMSO or ethanol |
| pka | 14.74±0.20(Predicted) |
| form | White crystalline powder. |
| color | White to off-white |
| biological source | synthetic |
| BRN | 4716773 |
| Stability | Light Sensitive, Temperature Sensitive |
| InChIKey | KJKIIUAXZGLUND-ICCVIKJNSA-N |
| SMILES | [C@H]1(O)CCC(=C)/C(=C\C=C2/CCC[C@@]3(C)[C@@]/2([H])CC[C@@H]3[C@H](C)/C=C/[C@H](C)C(O)(C)C)/C1 |
| CAS DataBase Reference | 21343-40-8(CAS DataBase Reference) |
| FDA UNII | A288AR3C9H |
| UNSPSC Code | 41116107 |
| NACRES | NA.28 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H319 | |||||||||
| Precautionary statements | P210-P305+P351+P338 | |||||||||
| Hazard Codes | T+,F | |||||||||
| Risk Statements | 24/25-26-48/25-11 | |||||||||
| Safety Statements | 28-36/37-45-16-7 | |||||||||
| RIDADR | UN2811 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8-10-19 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Dermal Acute Tox. 3 Oral STOT RE 1 Oral | |||||||||
| NFPA 704: |
|
