4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate
- Product Name4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate
- CAS7612-98-8
- CBNumberCB9116830
- MFC15H14N4S
- MW282.36
- EINECS231-521-3
- MDL NumberMFCD00004812
- MOL File7612-98-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 167-171 °C(lit.) |
| Boiling point | 466.2±30.0 °C(Predicted) |
| Density | 1.2493 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | room temp |
| solubility | dioxane: 20 mg/mL, clear, red |
| pka | 3.28±0.10(Predicted) |
| form | powder to crystal |
| color | Orange to Brown |
| Sensitive | Moisture Sensitive |
| BRN | 752568 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C15H14N4S/c1-19(2)15-9-7-14(8-10-15)18-17-13-5-3-12(4-6-13)16-11-20/h3-10H,1-2H3/b18-17+ |
| InChIKey | OSWZKAVBSQAVFI-ISLYRVAYSA-N |
| SMILES | CN(C)c1ccc(cc1)\N=N\c2ccc(cc2)N=C=S |
| CAS DataBase Reference | 7612-98-8(CAS DataBase Reference) |
| UNSPSC Code | 12171500 |
| NACRES | NA.47 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H317-H334 | |||||||||
| Precautionary statements | P261-P280-P342+P311 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 42 | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| RIDADR | 3234 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NX9125000 | |||||||||
| F | 10-21 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29309090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 | |||||||||
| NFPA 704: |
|