N,N-Dimethyl-4,4'-azodianiline
- Product NameN,N-Dimethyl-4,4'-azodianiline
- CAS539-17-3
- CBNumberCB3737077
- MFC14H16N4
- MW240.3
- EINECS208-712-5
- MDL NumberMFCD00010204
- MOL File539-17-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 190-195 °C (dec.) |
| Boiling point | 373.02°C (rough estimate) |
| Density | 1.0236 (rough estimate) |
| refractive index | 1.4850 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.43±0.10(Predicted) |
| form | powder to crystal |
| color | Yellow to Amber to Dark red |
| Water Solubility | 120.2ug/L(25 ºC) |
| BRN | 748253 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H16N4/c1-18(2)14-9-7-13(8-10-14)17-16-12-5-3-11(15)4-6-12/h3-10H,15H2,1-2H3/b17-16+ |
| InChIKey | BVRIUXYMUSKBHG-WUKNDPDISA-N |
| SMILES | CN(C)c1ccc(cc1)\N=N\c2ccc(N)cc2 |
| CAS DataBase Reference | 539-17-3(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| EPA Substance Registry System | Benzenamine, 4-[(4-aminophenyl)azo]-N,N-dimethyl- (539-17-3) |
| UNSPSC Code | 12171500 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | BX5020000 | |||||||||
| F | 8-9-23 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29270000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
