(-)-Camphene
- Product Name(-)-Camphene
- CAS5794-04-7
- CBNumberCB8468970
- MFC10H16
- MW136.23
- EINECS227-337-8
- MDL NumberMFCD00066603
- MOL File5794-04-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 36-38 °C(lit.) |
| Boiling point | 157.5-158.5 °C(lit.) |
| Density | 0.84 g/mL at 25 °C(lit.) |
| refractive index | 1.4562 (estimate) |
| Flash point | 98 °F |
| solubility | Benzene (Slightly), Chloroform (Sparingly) |
| form | Solid |
| color | White to Off-White Waxy |
| Odor | at 10.00 % in dipropylene glycol. fresh woody fir terpene |
| Odor Type | woody |
| optical activity | [α]20/D -48°, c =4 in ethanol [α]25/D -35 to -43°, c =4 in ethanol |
| Merck | 14,1730 |
| Stability | Volatile |
| InChI | 1S/C10H16/c1-7-8-4-5-9(6-8)10(7,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9+/m1/s1 |
| InChIKey | CRPUJAZIXJMDBK-BDAKNGLRSA-N |
| SMILES | CC1(C)[C@H]2CC[C@H](C2)C1=C |
| LogP | 4.239 (est) |
| EWG's Food Scores | 1 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H319-H410 | |||||||||
| Precautionary statements | P273-P391-P501-P264-P280-P305+P351+P338-P337+P313P | |||||||||
| Hazard Codes | F | |||||||||
| Risk Statements | 11-10 | |||||||||
| Safety Statements | 16-33-29 | |||||||||
| RIDADR | UN 1325 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | EX1055000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 4.1B - Flammable solid hazardous materials | |||||||||
| Hazard Classifications | Flam. Sol. 1 | |||||||||
| NFPA 704: |
|