1,3,5-Triglycidyl isocyanurate
- Product Name1,3,5-Triglycidyl isocyanurate
- CAS2451-62-9
- CBNumberCB8322836
- MFC12H15N3O6
- MW297.26
- EINECS219-514-3
- MDL NumberMFCD00080670
- MOL File2451-62-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 95-98°C |
| Boiling point | 438.78°C (rough estimate) |
| Density | 1,42 g/cm3 |
| vapor pressure | 0.007Pa at 20℃ |
| refractive index | 1.5290 (estimate) |
| storage temp. | Store at 4°C |
| solubility | DMSO: 50 mg/mL (168.20 mM) |
| form | powder to crystal |
| pka | -2.44±0.20(Predicted) |
| color | White to Almost white |
| Water Solubility | <0.1 g/100 mL at 20 ºC |
| InChI | InChI=1S/C12H15N3O6/c16-10-13(1-7-4-19-7)11(17)15(3-9-6-21-9)12(18)14(10)2-8-5-20-8/h7-9H,1-6H2 |
| InChIKey | OUPZKGBUJRBPGC-UHFFFAOYSA-N |
| SMILES | N1(CC2CO2)C(=O)N(CC2CO2)C(=O)N(CC2CO2)C1=O |
| LogP | -0.8 at 20℃ |
| Substances of Very High Concern (SVHC) Candidate List | 1,3,5-Tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione (TGIC) (2451-62-9) |
| FDA 21 CFR | 177.2420 |
| CAS DataBase Reference | 2451-62-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H331-H317-H318-H340-H373-H412 | |||||||||
| Precautionary statements | P201-P273-P280-P301+P310+P330-P304+P340+P311-P305+P351+P338+P310 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 46-23/25-41-43-48/22-52/53 | |||||||||
| Safety Statements | 53-45-61 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | XZ1994900 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29299090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 Eye Dam. 1 Muta. 1B Skin Sens. 1 STOT RE 2 | |||||||||
| Hazardous Substances Data | 2451-62-9(Hazardous Substances Data) | |||||||||
| Toxicity | LD50 oral in rat: 188mg/kg | |||||||||
| NFPA 704: |
|
