N-Aminophthalimide
- Product NameN-Aminophthalimide
- CAS1875-48-5
- CBNumberCB8306393
- MFC8H6N2O2
- MW162.15
- EINECS217-505-9
- MDL NumberMFCD00005895
- MOL File1875-48-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 200-202 °C(lit.) |
| Boiling point | 288.82°C (rough estimate) |
| Density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Solubility in hot methanol almost transparent. |
| pka | -1.73±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 383756 |
| InChI | InChI=1S/C8H6N2O2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,9H2 |
| InChIKey | KSILMCDYDAKOJD-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1N |
| CAS DataBase Reference | 1875-48-5(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H315-H317-H319-H334-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 36/37/38-42/43 | |||||||||
| Safety Statements | 22-26-36/37-45 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 9 | |||||||||
| HS Code | 29251900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 | |||||||||
| NFPA 704: |
|
