1875-48-5
| Name | N-AMINOPHTHALIMIDE |
| CAS | 1875-48-5 |
| EINECS(EC#) | 217-505-9 |
| Molecular Formula | C8H6N2O2 |
| MDL Number | MFCD00005895 |
| Molecular Weight | 162.15 |
| MOL File | 1875-48-5.mol |
Chemical Properties
| Appearance | white to off-white crystalline powder |
| Melting point | 200-202 °C(lit.) |
| Boiling point | 288.82°C (rough estimate) |
| density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | 2-8°C |
| solubility | Solubility in hot methanol almost transparent. |
| form | powder to crystal |
| pka | -1.73±0.20(Predicted) |
| color | White to Light yellow |
| BRN | 383756 |
| InChI | InChI=1S/C8H6N2O2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,9H2 |
| InChIKey | KSILMCDYDAKOJD-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1N |
| CAS DataBase Reference | 1875-48-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 9 |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |