5-Fluoro-2-iodobenzoic acid
- Product Name5-Fluoro-2-iodobenzoic acid
- CAS52548-63-7
- CBNumberCB7947162
- MFC7H4FIO2
- MW266.01
- MDL NumberMFCD00837316
- MOL File52548-63-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 145-149 °C |
| Boiling point | 307.9±27.0 °C(Predicted) |
| Density | 2.074±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.52±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H4FIO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | XPFMQYOPTHMSJJ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC=C1I |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H319-H335 | |||||||||
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 25-36/37/38 | |||||||||
| Safety Statements | 26-45 | |||||||||
| RIDADR | UN 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 2916310090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
