6,6'-Dithiodinicotinic acid
- Product Name6,6'-Dithiodinicotinic acid
- CAS15658-35-2
- CBNumberCB7689419
- MFC12H8N2O4S2
- MW308.33
- EINECS239-729-6
- MDL NumberMFCD00006454
- MOL File15658-35-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 263-265 °C(lit.) |
| Boiling point | 584.2±50.0 °C(Predicted) |
| Density | 1.66±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.82±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12H8N2O4S2/c15-11(16)7-1-3-9(13-5-7)19-20-10-4-2-8(6-14-10)12(17)18/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | GSASOFRDSIKDSN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(SSc2ccc(cn2)C(O)=O)nc1 |
| CAS DataBase Reference | 15658-35-2(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | US5684700 | |||||||||
| HS Code | 2933399990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
