AFLATOXIN M1
- Product NameAFLATOXIN M1
- CAS6795-23-9
- CBNumberCB7494530
- MFC17H12O7
- MW328.27
- EINECS229-865-4
- MDL NumberMFCD00871812
- MOL File6795-23-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 299℃ |
| alpha | D -280° (c = 0.1 in DMF) |
| Boiling point | 386.03°C (rough estimate) |
| Density | 1.3358 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Flash point | 11 °C |
| storage temp. | 2-8°C |
| solubility | Acetonitrile:Methanol (1:1): 1 mg/ml |
| form | White to yellow powder. |
| pka | 10.76±0.20(Predicted) |
| color | White to off-white |
| BRN | 1630643 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C17H12O7/c1-21-9-6-10-13(17(20)4-5-22-16(17)23-10)14-12(9)7-2-3-8(18)11(7)15(19)24-14/h4-6,16,20H,2-3H2,1H3/t16-,17-/m1/s1 |
| InChIKey | MJBWDEQAUQTVKK-IAGOWNOFSA-N |
| SMILES | C1(=O)OC2C3[C@]4(O)C=CO[C@]4([H])OC=3C=C(OC)C=2C2CCC(=O)C1=2 |
| FDA UNII | I3020O28I3 |
| UNSPSC Code | 85151701 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300+H310+H330-H340-H350 | |||||||||
| Precautionary statements | P202-P260-P264-P280-P302+P352+P310-P304+P340+P310 | |||||||||
| Hazard Codes | T+,T,F,Xn | |||||||||
| Risk Statements | 26/27/28-40-39/23/24/25-23/25-23/24/25-11-36-20/21/22-45 | |||||||||
| Safety Statements | 53-22-36/37/39-45-24-16-7-36-26-36/37-28 | |||||||||
| RIDADR | UN 3462 6.1/PG 1 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | GY1880000 | |||||||||
| F | 10-23 | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | I | |||||||||
| HS Code | 29322090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 | |||||||||
| Toxicity | LD50 orally in day old Pekin ducklings: 16.6 mg/duckling (Holzapfel, Steyn) | |||||||||
| NFPA 704: |
|