
6795-23-9
| Name | AFLATOXIN M1 |
| CAS | 6795-23-9 |
| EINECS(EC#) | 229-865-4 |
| Molecular Formula | C17H12O7 |
| MDL Number | MFCD00871812 |
| Molecular Weight | 328.27 |
| MOL File | 6795-23-9.mol |
Chemical Properties
| Appearance | The aflatoxins are a group of molds produced by the fungus Aspergillus flavus. They are natural contaminants of fruits, vegetables, and grains. They are also described as a series of condensed ring heterocyclic compounds. They form colorless to pale yellow crystals. Practically insoluble in water. |
| Melting point | 299℃ |
| alpha | D -280° (c = 0.1 in DMF) |
| Boiling point | 386.03°C (rough estimate) |
| density | 1.3358 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Fp | 11 °C |
| storage temp. | 2-8°C |
| solubility | Acetonitrile:Methanol (1:1): 1 mg/ml |
| form | White to yellow powder. |
| pka | 10.76±0.20(Predicted) |
| color | White to off-white |
| BRN | 1630643 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C17H12O7/c1-21-9-6-10-13(17(20)4-5-22-16(17)23-10)14-12(9)7-2-3-8(18)11(7)15(19)24-14/h4-6,16,20H,2-3H2,1H3/t16-,17-/m1/s1 |
| InChIKey | MJBWDEQAUQTVKK-IAGOWNOFSA-N |
| SMILES | C1(=O)OC2C3[C@]4(O)C=CO[C@]4([H])OC=3C=C(OC)C=2C2CCC(=O)C1=2 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H340-H350 |
| Precautionary statements | P202-P260-P264-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+,T,F,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | GY1880000 |
| F | 10-23 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29322090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Safety Profile | |
| Toxicity |

