AFLATOXIN G2
- Product NameAFLATOXIN G2
- CAS7241-98-7
- CBNumberCB3291098
- MFC17H14O7
- MW330.29
- EINECS230-643-4
- MDL NumberMFCD00078141
- MOL File7241-98-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 237-240 °C |
| alpha | D -473° (c = 0.084 in chloroform) |
| Boiling point | 387.74°C (rough estimate) |
| Density | 1.3099 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Flash point | 2 °C |
| storage temp. | 2-8°C |
| solubility | DMF: Soluble; DMSO: Soluble; Ethanol: Soluble; Methanol: Soluble |
| form | White to yellow powder. Blue-green fluorescence. |
| color | White to off-white |
| Water Solubility | 15mg/L(temperature not stated) |
| BRN | 1692017 |
| Henry's Law Constant | 9.0×108 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C17H14O7/c1-20-9-6-10-12(8-3-5-22-17(8)23-10)14-11(9)7-2-4-21-15(18)13(7)16(19)24-14/h6,8,17H,2-5H2,1H3/t8-,17+/m0/s1 |
| InChIKey | WPCVRWVBBXIRMA-WNWIJWBNSA-N |
| SMILES | C1(=O)OC2C3[C@]4([H])CCO[C@]4([H])OC=3C=C(OC)C=2C2CCOC(=O)C1=2 |
| LogP | 0.443 (est) |
Safety
| Symbol(GHS) |
![]() ![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H304-H315-H319-H340-H350-H372-H412 | |||||||||
| Precautionary statements | P210-P273-P301+P310-P303+P361+P353-P305+P351+P338-P331 | |||||||||
| Hazard Codes | T+,T,Xn,F | |||||||||
| Risk Statements | 45-26/27/28-36-20/21/22-11-39/23/24/25-23/24/25-65-48/23/24/25-36/38-46 | |||||||||
| Safety Statements | 53-28-36/37-45-36-26-16-7-62 | |||||||||
| RIDADR | UN 3462 6.1/PG 1 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | LV1700000 | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | I | |||||||||
| HS Code | 30029090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 | |||||||||
| Hazardous Substances Data | 7241-98-7(Hazardous Substances Data) | |||||||||
| Toxicity | LD50 orally in day old duckling: 172.5 mg/50 gm body wt (Carnaghan) | |||||||||
| NFPA 704: |
|

